C17H15FN6S — CID 123266431
1-[(2-fluorophenyl)methyl]-N-methylidene-N'-prop-1-enyl-5-(1,3-thiazol-4-yl)-1,2,4-triazole-3-carboximidamide (PubChem CID 123266431) has the molecular formula C17H15FN6S and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-prop-1-enyl-5-(1,3-thiazol-4-yl)-1,2,4-triazole-3-carboximidamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-prop-1-enyl-5-(1,3-thiazol-4-yl)-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 123266431 |
| Molecular Formula | C17H15FN6S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-methylidene-N'-prop-1-enyl-5-(1,3-thiazol-4-yl)-1,2,4-triazole-3-carboximidamide |
| SMILES | C=N/C(=N\C=CC)c1nc(-c2cscn2)n(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C17H15FN6S/c1-3-8-20-15(19-2)16-22-17(14-10-25-11-21-14)24(23-16)9-12-6-4-5-7-13(12)18/h3-8,10-11H,2,9H2,1H3/b8-3?,20-15- |
| InChIKey | JNHZDNUZHPBXMG-RYWIKFNSSA-N |
| XLogP | 3.57 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|