C14H40Si5 — CID 123266517
dimethyl-bis[[methyl(trimethylsilylmethyl)silyl]methyl]silane (PubChem CID 123266517) has the molecular formula C14H40Si5 and a molecular weight of 348.90 g/mol. Its IUPAC name is dimethyl-bis[[methyl(trimethylsilylmethyl)silyl]methyl]silane.
| Compound Name | dimethyl-bis[[methyl(trimethylsilylmethyl)silyl]methyl]silane |
|---|---|
| PubChem CID | 123266517 |
| Molecular Formula | C14H40Si5 |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | dimethyl-bis[[methyl(trimethylsilylmethyl)silyl]methyl]silane |
| SMILES | C[SiH](C[Si](C)(C)C)C[Si](C)(C)C[SiH](C)C[Si](C)(C)C |
| InChI | InChI=1S/C14H40Si5/c1-15(11-17(3,4)5)13-19(9,10)14-16(2)12-18(6,7)8/h15-16H,11-14H2,1-10H3 |
| InChIKey | LOJLKNOBCYUMFQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|