C19H29NO4 — CID 123267612
4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-2-hydroxy-2-methyl-N-(3-methylbutyl)but-3-enamide (PubChem CID 123267612) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-2-hydroxy-2-methyl-N-(3-methylbutyl)but-3-enamide.
| Compound Name | 4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-2-hydroxy-2-methyl-N-(3-methylbutyl)but-3-enamide |
|---|---|
| PubChem CID | 123267612 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 4-(2,5-dihydroxy-3,4,6-trimethylphenyl)-2-hydroxy-2-methyl-N-(3-methylbutyl)but-3-enamide |
| SMILES | Cc1c(C)c(O)c(C=CC(C)(O)C(=O)NCCC(C)C)c(C)c1O |
| InChI | InChI=1S/C19H29NO4/c1-11(2)8-10-20-18(23)19(6,24)9-7-15-14(5)16(21)12(3)13(4)17(15)22/h7,9,11,21-22,24H,8,10H2,1-6H3,(H,20,23) |
| InChIKey | NVKWAPFKBBSDMD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|