C19H23NO6 — CID 123267762
ethyl 1-benzyl-2-(3-ethoxyoxetan-3-yl)-4,5-dioxopyrrolidine-3-carboxylate (PubChem CID 123267762) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is ethyl 1-benzyl-2-(3-ethoxyoxetan-3-yl)-4,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-2-(3-ethoxyoxetan-3-yl)-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 123267762 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl 1-benzyl-2-(3-ethoxyoxetan-3-yl)-4,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C(=O)N(Cc2ccccc2)C1C1(OCC)COC1 |
| InChI | InChI=1S/C19H23NO6/c1-3-25-18(23)14-15(21)17(22)20(10-13-8-6-5-7-9-13)16(14)19(26-4-2)11-24-12-19/h5-9,14,16H,3-4,10-12H2,1-2H3 |
| InChIKey | DZIKMSJFNFTVSV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|