C18H21NO6 — CID 139232623
methyl (3S,5R)-1-benzyl-3-(2-ethoxy-2-oxoethyl)-5-methyl-2,4-dioxopyrrolidine-3-carboxylate (PubChem CID 139232623) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl (3S,5R)-1-benzyl-3-(2-ethoxy-2-oxoethyl)-5-methyl-2,4-dioxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,5R)-1-benzyl-3-(2-ethoxy-2-oxoethyl)-5-methyl-2,4-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139232623 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl (3S,5R)-1-benzyl-3-(2-ethoxy-2-oxoethyl)-5-methyl-2,4-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C[C@]1(C(=O)OC)C(=O)[C@@H](C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H21NO6/c1-4-25-14(20)10-18(17(23)24-3)15(21)12(2)19(16(18)22)11-13-8-6-5-7-9-13/h5-9,12H,4,10-11H2,1-3H3/t12-,18+/m1/s1 |
| InChIKey | NRZZSDBLWYAVGV-XIKOKIGWSA-N |
| XLogP | 1.10 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|