C18H21NO5 — CID 101401508
ethyl 2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-2-methyl-3-oxobutanoate (PubChem CID 101401508) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-2-methyl-3-oxobutanoate.
| Compound Name | ethyl 2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 101401508 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 2-(1-benzyl-2,5-dioxopyrrolidin-3-yl)-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C(C)=O)C1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H21NO5/c1-4-24-17(23)18(3,12(2)20)14-10-15(21)19(16(14)22)11-13-8-6-5-7-9-13/h5-9,14H,4,10-11H2,1-3H3 |
| InChIKey | NATHYTDZKRIGIA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|