C17H16FNO4 — CID 54756621
ethyl 2-[(3S)-1-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate (PubChem CID 54756621) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is ethyl 2-[(3S)-1-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate.
| Compound Name | ethyl 2-[(3S)-1-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
|---|---|
| PubChem CID | 54756621 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | ethyl 2-[(3S)-1-[(4-fluorophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)OCC)[C@@H]1CC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H16FNO4/c1-3-13(17(22)23-4-2)14-9-15(20)19(16(14)21)10-11-5-7-12(18)8-6-11/h5-8,14H,1,4,9-10H2,2H3/t14-/m0/s1 |
| InChIKey | CCZWISWBWOLZIA-AWEZNQCLSA-N |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|