C18H17NO4 — CID 139260063
(3S)-1-benzyl-3-(5-oxo-3-prop-2-enyl-2H-furan-4-yl)pyrrolidine-2,5-dione (PubChem CID 139260063) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3S)-1-benzyl-3-(5-oxo-3-prop-2-enyl-2H-furan-4-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-benzyl-3-(5-oxo-3-prop-2-enyl-2H-furan-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139260063 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3S)-1-benzyl-3-(5-oxo-3-prop-2-enyl-2H-furan-4-yl)pyrrolidine-2,5-dione |
| SMILES | C=CCC1=C([C@@H]2CC(=O)N(Cc3ccccc3)C2=O)C(=O)OC1 |
| InChI | InChI=1S/C18H17NO4/c1-2-6-13-11-23-18(22)16(13)14-9-15(20)19(17(14)21)10-12-7-4-3-5-8-12/h2-5,7-8,14H,1,6,9-11H2/t14-/m0/s1 |
| InChIKey | LWLVOWIICFMHNS-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|