C36H43N5O3 — CID 123268168
2-(4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 123268168) has the molecular formula C36H43N5O3 and a molecular weight of 593.77 g/mol. Its IUPAC name is 2-(4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-(4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 123268168 |
| Molecular Formula | C36H43N5O3 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 2-(4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl)-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1nc2cc3nn2c(c1C(OC(C)(C)C)C(=O)O)N1CCC(C)(CCC=CCCc2ccncc2-c2cccc-3c2)CC1 |
| InChI | InChI=1S/C36H43N5O3/c1-24-31(32(34(42)43)44-35(2,3)4)33-40-19-16-36(5,17-20-40)15-9-7-6-8-11-25-14-18-37-23-28(25)26-12-10-13-27(21-26)29-22-30(38-24)41(33)39-29/h6-7,10,12-14,18,21-23,32H,8-9,11,15-17,19-20H2,1-5H3,(H,42,43) |
| InChIKey | LEHOTKSPSGCUSA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|