C38H51N5O3 — CID 144574498
2-[(23Z)-4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol (PubChem CID 144574498) has the molecular formula C38H51N5O3 and a molecular weight of 625.86 g/mol. Its IUPAC name is 2-[(23Z)-4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol.
| Compound Name | 2-[(23Z)-4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 144574498 |
| Molecular Formula | C38H51N5O3 |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | 2-[(23Z)-4,27-dimethyl-1,5,7,8,17-pentazahexacyclo[25.2.2.16,9.110,14.02,7.015,20]tritriaconta-2,4,6(33),8,10(32),11,13,15(20),16,18,23-undecaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol |
| SMILES | CC.CC(C)(C)O.Cc1nc2cc3nn2c(c1CC(=O)O)N1CCC(C)(CC/C=C/CCc2ccncc2-c2cccc-3c2)CC1 |
| InChI | InChI=1S/C32H35N5O2.C4H10O.C2H6/c1-22-26(19-30(38)39)31-36-16-13-32(2,14-17-36)12-6-4-3-5-8-23-11-15-33-21-27(23)24-9-7-10-25(18-24)28-20-29(34-22)37(31)35-28;1-4(2,3)5;1-2/h3-4,7,9-11,15,18,20-21H,5-6,8,12-14,16-17,19H2,1-2H3,(H,38,39);5H,1-3H3;1-2H3/b4-3+;; |
| InChIKey | NCCPCGPORYWUHJ-CZEFNJPISA-N |
| XLogP | 8.09 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|