C34H53N7O5 — CID 144908162
2-[(12Z)-11,13-diamino-4,25-dimethyl-19,24-dioxa-1,5,7,8,11-pentazapentacyclo[23.2.2.16,9.114,18.02,7]hentriaconta-2,4,6(31),8,12,14(30),15,17-octaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol (PubChem CID 144908162) has the molecular formula C34H53N7O5 and a molecular weight of 639.84 g/mol. Its IUPAC name is 2-[(12Z)-11,13-diamino-4,25-dimethyl-19,24-dioxa-1,5,7,8,11-pentazapentacyclo[23.2.2.16,9.114,18.02,7]hentriaconta-2,4,6(31),8,12,14(30),15,17-octaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol.
| Compound Name | 2-[(12Z)-11,13-diamino-4,25-dimethyl-19,24-dioxa-1,5,7,8,11-pentazapentacyclo[23.2.2.16,9.114,18.02,7]hentriaconta-2,4,6(31),8,12,14(30),15,17-octaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 144908162 |
| Molecular Formula | C34H53N7O5 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.41 |
| IUPAC Name | 2-[(12Z)-11,13-diamino-4,25-dimethyl-19,24-dioxa-1,5,7,8,11-pentazapentacyclo[23.2.2.16,9.114,18.02,7]hentriaconta-2,4,6(31),8,12,14(30),15,17-octaen-3-yl]acetic acid;ethane;2-methylpropan-2-ol |
| SMILES | CC.CC(C)(C)O.Cc1nc2cc3nn2c(c1CC(=O)O)N1CCC(C)(CC1)OCCCCOc1cccc(c1)/C(N)=C/N(N)C3 |
| InChI | InChI=1S/C28H37N7O4.C4H10O.C2H6/c1-19-23(16-26(36)37)27-33-10-8-28(2,9-11-33)39-13-4-3-12-38-22-7-5-6-20(14-22)24(29)18-34(30)17-21-15-25(31-19)35(27)32-21;1-4(2,3)5;1-2/h5-7,14-15,18H,3-4,8-13,16-17,29-30H2,1-2H3,(H,36,37);5H,1-3H3;1-2H3/b24-18-;; |
| InChIKey | PHNXIACNHLZQFU-LLZNVLRPSA-N |
| XLogP | 4.65 |
| TPSA | 164.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|