C13H18O3 — CID 123268427
2,5-bis(2-methoxyethyl)benzaldehyde (PubChem CID 123268427) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2,5-bis(2-methoxyethyl)benzaldehyde.
| Compound Name | 2,5-bis(2-methoxyethyl)benzaldehyde |
|---|---|
| PubChem CID | 123268427 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2,5-bis(2-methoxyethyl)benzaldehyde |
| SMILES | COCCc1ccc(CCOC)c(C=O)c1 |
| InChI | InChI=1S/C13H18O3/c1-15-7-5-11-3-4-12(6-8-16-2)13(9-11)10-14/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | YZUDLRMSJWPJPL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|