C27H30O5 — CID 58716566
2-(2-phenylethyl)-5-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]benzaldehyde (PubChem CID 58716566) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-(2-phenylethyl)-5-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]benzaldehyde.
| Compound Name | 2-(2-phenylethyl)-5-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 58716566 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-(2-phenylethyl)-5-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]benzaldehyde |
| SMILES | COc1c(C)c(Cc2ccc(CCc3ccccc3)c(C=O)c2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C27H30O5/c1-18-23(25(30-3)27(32-5)26(31-4)24(18)29-2)16-20-12-14-21(22(15-20)17-28)13-11-19-9-7-6-8-10-19/h6-10,12,14-15,17H,11,13,16H2,1-5H3 |
| InChIKey | HXAIKSUIJXOGME-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|