C26H28O6 — CID 139994575
2-[1-phenyl-2-(2,3,4,5-tetramethoxy-6-methylphenyl)ethoxy]benzaldehyde (PubChem CID 139994575) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-[1-phenyl-2-(2,3,4,5-tetramethoxy-6-methylphenyl)ethoxy]benzaldehyde.
| Compound Name | 2-[1-phenyl-2-(2,3,4,5-tetramethoxy-6-methylphenyl)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 139994575 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[1-phenyl-2-(2,3,4,5-tetramethoxy-6-methylphenyl)ethoxy]benzaldehyde |
| SMILES | COc1c(C)c(CC(Oc2ccccc2C=O)c2ccccc2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C26H28O6/c1-17-20(24(29-3)26(31-5)25(30-4)23(17)28-2)15-22(18-11-7-6-8-12-18)32-21-14-10-9-13-19(21)16-27/h6-14,16,22H,15H2,1-5H3 |
| InChIKey | VMBJQHFBPLQMDL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|