C24H28N4O7 — CID 160981987
1,3-didiazopropan-2-one;3-[3-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenyl]propanoic acid (PubChem CID 160981987) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is 1,3-didiazopropan-2-one;3-[3-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenyl]propanoic acid.
| Compound Name | 1,3-didiazopropan-2-one;3-[3-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 160981987 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1,3-didiazopropan-2-one;3-[3-[(2,3,4,5-tetramethoxy-6-methylphenyl)methyl]phenyl]propanoic acid |
| SMILES | COc1c(C)c(Cc2cccc(CCC(=O)O)c2)c(OC)c(OC)c1OC.[N-]=[N+]=CC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C21H26O6.C3H2N4O/c1-13-16(12-15-8-6-7-14(11-15)9-10-17(22)23)19(25-3)21(27-5)20(26-4)18(13)24-2;4-6-1-3(8)2-7-5/h6-8,11H,9-10,12H2,1-5H3,(H,22,23);1-2H |
| InChIKey | SZQDIKFKYIAHQZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|