C8H20N2S — CID 123272375
N',N'-diethyl-N-methylsulfanylpropane-1,3-diamine (PubChem CID 123272375) has the molecular formula C8H20N2S and a molecular weight of 176.33 g/mol. Its IUPAC name is N',N'-diethyl-N-methylsulfanylpropane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-methylsulfanylpropane-1,3-diamine |
|---|---|
| PubChem CID | 123272375 |
| Molecular Formula | C8H20N2S |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N',N'-diethyl-N-methylsulfanylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNSC |
| InChI | InChI=1S/C8H20N2S/c1-4-10(5-2)8-6-7-9-11-3/h9H,4-8H2,1-3H3 |
| InChIKey | DMDLDNPAQITVOX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|