C19H22FN3O — CID 123272879
4-[[3,4-diamino-N-[(4-fluorophenyl)methyl]anilino]methyl]penta-2,4-dien-1-ol (PubChem CID 123272879) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is 4-[[3,4-diamino-N-[(4-fluorophenyl)methyl]anilino]methyl]penta-2,4-dien-1-ol.
| Compound Name | 4-[[3,4-diamino-N-[(4-fluorophenyl)methyl]anilino]methyl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123272879 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-[[3,4-diamino-N-[(4-fluorophenyl)methyl]anilino]methyl]penta-2,4-dien-1-ol |
| SMILES | C=C(C=CCO)CN(Cc1ccc(F)cc1)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C19H22FN3O/c1-14(3-2-10-24)12-23(13-15-4-6-16(20)7-5-15)17-8-9-18(21)19(22)11-17/h2-9,11,24H,1,10,12-13,21-22H2 |
| InChIKey | JZFAZQVQJACGRL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|