C11H13FN2 — CID 130222853
(1Z)-1-N-(4-fluorophenyl)-1-N-methylbuta-1,3-diene-1,3-diamine (PubChem CID 130222853) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is (1Z)-1-N-(4-fluorophenyl)-1-N-methylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-1-N-(4-fluorophenyl)-1-N-methylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 130222853 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (1Z)-1-N-(4-fluorophenyl)-1-N-methylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(N)/C=C\N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN2/c1-9(13)7-8-14(2)11-5-3-10(12)4-6-11/h3-8H,1,13H2,2H3/b8-7- |
| InChIKey | XDMIJDCDKHEGRD-FPLPWBNLSA-N |
| XLogP | 2.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|