C14H12BrN3OS — CID 123272996
3-amino-4-(bromomethyl)-N-[(2-cyanophenyl)methyl]thiophene-2-carboxamide (PubChem CID 123272996) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is 3-amino-4-(bromomethyl)-N-[(2-cyanophenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-amino-4-(bromomethyl)-N-[(2-cyanophenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 123272996 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 3-amino-4-(bromomethyl)-N-[(2-cyanophenyl)methyl]thiophene-2-carboxamide |
| SMILES | N#Cc1ccccc1CNC(=O)c1scc(CBr)c1N |
| InChI | InChI=1S/C14H12BrN3OS/c15-5-11-8-20-13(12(11)17)14(19)18-7-10-4-2-1-3-9(10)6-16/h1-4,8H,5,7,17H2,(H,18,19) |
| InChIKey | XSZIVUPWAGGIMM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|