C26H24F3N7O — CID 123273872
1-[[6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]propan-2-ol (PubChem CID 123273872) has the molecular formula C26H24F3N7O and a molecular weight of 507.52 g/mol. Its IUPAC name is 1-[[6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]propan-2-ol.
| Compound Name | 1-[[6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 123273872 |
| Molecular Formula | C26H24F3N7O |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 1-[[6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]propan-2-ol |
| SMILES | Cc1c(-c2ccnn2-c2ccc(N)cc2)cn2nc(NCC(C)O)nc2c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H24F3N7O/c1-15(37)13-31-25-33-24-23(17-4-3-5-18(12-17)26(27,28)29)16(2)21(14-35(24)34-25)22-10-11-32-36(22)20-8-6-19(30)7-9-20/h3-12,14-15,37H,13,30H2,1-2H3,(H,31,34) |
| InChIKey | NGINBLPYAXALQI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|