C27H27F3N6O2 — CID 147946887
5-[2-(4-aminophenyl)pyrazol-3-yl]-N-[2-(dimethylamino)ethyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 147946887) has the molecular formula C27H27F3N6O2 and a molecular weight of 524.55 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)pyrazol-3-yl]-N-[2-(dimethylamino)ethyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-[2-(4-aminophenyl)pyrazol-3-yl]-N-[2-(dimethylamino)ethyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 147946887 |
| Molecular Formula | C27H27F3N6O2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 5-[2-(4-aminophenyl)pyrazol-3-yl]-N-[2-(dimethylamino)ethyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1c(-c2ccnn2-c2ccc(N)cc2)cc(C(=O)NCCN(C)C)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F3N6O2/c1-17-22(24-11-12-33-36(24)20-9-7-19(31)8-10-20)16-23(25(37)32-13-14-34(2)3)26(38)35(17)21-6-4-5-18(15-21)27(28,29)30/h4-12,15-16H,13-14,31H2,1-3H3,(H,32,37) |
| InChIKey | IMVMIXCTRONNHZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|