C20H19F3N6O3 — CID 91039389
N-(2-amino-2-hydroxyiminoethyl)-6-methyl-5-(2-methylpyrazol-3-yl)-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 91039389) has the molecular formula C20H19F3N6O3 and a molecular weight of 448.41 g/mol. Its IUPAC name is N-(2-amino-2-hydroxyiminoethyl)-6-methyl-5-(2-methylpyrazol-3-yl)-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-2-hydroxyiminoethyl)-6-methyl-5-(2-methylpyrazol-3-yl)-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91039389 |
| Molecular Formula | C20H19F3N6O3 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-(2-amino-2-hydroxyiminoethyl)-6-methyl-5-(2-methylpyrazol-3-yl)-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1c(-c2ccnn2C)cc(C(=O)NCC(N)=NO)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N6O3/c1-11-14(16-6-7-26-28(16)2)9-15(18(30)25-10-17(24)27-32)19(31)29(11)13-5-3-4-12(8-13)20(21,22)23/h3-9,32H,10H2,1-2H3,(H2,24,27)(H,25,30) |
| InChIKey | HBRPLCZPBRZYMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|