C50H35N2OS+ — CID 123275634
2-[4-[2'-(1-ethyl-8-methoxyquinolin-1-ium-5-yl)-9,9'-spirobi[fluorene]-2-yl]phenyl]-1,3-benzothiazole (PubChem CID 123275634) has the molecular formula C50H35N2OS+ and a molecular weight of 711.91 g/mol. Its IUPAC name is 2-[4-[2'-(1-ethyl-8-methoxyquinolin-1-ium-5-yl)-9,9'-spirobi[fluorene]-2-yl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[2'-(1-ethyl-8-methoxyquinolin-1-ium-5-yl)-9,9'-spirobi[fluorene]-2-yl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 123275634 |
| Molecular Formula | C50H35N2OS+ |
| Molecular Weight | 711.91 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | 2-[4-[2'-(1-ethyl-8-methoxyquinolin-1-ium-5-yl)-9,9'-spirobi[fluorene]-2-yl]phenyl]-1,3-benzothiazole |
| SMILES | CC[n+]1cccc2c(-c3ccc4c(c3)C3(c5ccccc5-c5ccc(-c6ccc(-c7nc8ccccc8s7)cc6)cc53)c3ccccc3-4)ccc(OC)c21 |
| InChI | InChI=1S/C50H35N2OS/c1-3-52-28-10-13-40-35(26-27-46(53-2)48(40)52)34-23-25-39-37-12-5-7-15-42(37)50(44(39)30-34)41-14-6-4-11-36(41)38-24-22-33(29-43(38)50)31-18-20-32(21-19-31)49-51-45-16-8-9-17-47(45)54-49/h4-30H,3H2,1-2H3/q+1 |
| InChIKey | SATDAGRTVWCXME-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.91 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|