C22H17ClN2OS — CID 164618723
2-(8-methoxy-5-methylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride (PubChem CID 164618723) has the molecular formula C22H17ClN2OS and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-(8-methoxy-5-methylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride.
| Compound Name | 2-(8-methoxy-5-methylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride |
|---|---|
| PubChem CID | 164618723 |
| Molecular Formula | C22H17ClN2OS |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(8-methoxy-5-methylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride |
| SMILES | COc1ccc2c(c1)c[n+](C)c1ccc(-c3nc4ccccc4s3)cc21.[Cl-] |
| InChI | InChI=1S/C22H17N2OS.ClH/c1-24-13-15-11-16(25-2)8-9-17(15)18-12-14(7-10-20(18)24)22-23-19-5-3-4-6-21(19)26-22;/h3-13H,1-2H3;1H/q+1;/p-1 |
| InChIKey | PLZPVNWEYVUXBH-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|