C28H29FN6O — CID 123275958
CID 123275958 (PubChem CID 123275958) has the molecular formula C28H29FN6O and a molecular weight of 484.58 g/mol.
| Compound Name | CID 123275958 |
|---|---|
| PubChem CID | 123275958 |
| Molecular Formula | C28H29FN6O |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | — |
| SMILES | COc1cc(CC2CC3(CC3)CN3C2=NN=CC32CNc3cc(F)ccc32)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C28H29FN6O/c1-18-13-34(17-31-18)24-6-3-19(10-25(24)36-2)9-20-12-27(7-8-27)16-35-26(20)33-32-15-28(35)14-30-23-11-21(29)4-5-22(23)28/h3-6,10-11,13,15,17,20,30H,7-9,12,14,16H2,1-2H3 |
| InChIKey | DCIOUHLUJIKEGX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |