C31H30F3N2+ — CID 123277423
10-benzyl-12,13-diethyl-12,13-dimethyl-16-(trifluoromethyl)-11-aza-8-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8(19),9,14,16-octaene (PubChem CID 123277423) has the molecular formula C31H30F3N2+ and a molecular weight of 487.59 g/mol. Its IUPAC name is 10-benzyl-12,13-diethyl-12,13-dimethyl-16-(trifluoromethyl)-11-aza-8-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8(19),9,14,16-octaene.
| Compound Name | 10-benzyl-12,13-diethyl-12,13-dimethyl-16-(trifluoromethyl)-11-aza-8-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8(19),9,14,16-octaene |
|---|---|
| PubChem CID | 123277423 |
| Molecular Formula | C31H30F3N2+ |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 10-benzyl-12,13-diethyl-12,13-dimethyl-16-(trifluoromethyl)-11-aza-8-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8(19),9,14,16-octaene |
| SMILES | CCC1(C)c2cc(C(F)(F)F)cc3c4ccccc4[n+]4cc(Cc5ccccc5)n(c4c23)C1(C)CC |
| InChI | InChI=1S/C31H30F3N2/c1-5-29(3)25-18-21(31(32,33)34)17-24-23-14-10-11-15-26(23)35-19-22(16-20-12-8-7-9-13-20)36(28(35)27(24)25)30(29,4)6-2/h7-15,17-19H,5-6,16H2,1-4H3/q+1 |
| InChIKey | SNVGRRPUJBNLNO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|