C12H23NO — CID 123278546
2-(1-methoxyethylidene)-N,3,4-trimethylhex-3-en-1-amine (PubChem CID 123278546) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-(1-methoxyethylidene)-N,3,4-trimethylhex-3-en-1-amine.
| Compound Name | 2-(1-methoxyethylidene)-N,3,4-trimethylhex-3-en-1-amine |
|---|---|
| PubChem CID | 123278546 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-(1-methoxyethylidene)-N,3,4-trimethylhex-3-en-1-amine |
| SMILES | CCC(C)=C(C)C(CNC)=C(C)OC |
| InChI | InChI=1S/C12H23NO/c1-7-9(2)10(3)12(8-13-5)11(4)14-6/h13H,7-8H2,1-6H3 |
| InChIKey | CDOGYUOTFQUAJU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|