C9H17NO — CID 144853398
(Z,2Z)-2-(1-methoxyethylidene)-N-methylpent-3-en-1-amine (PubChem CID 144853398) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z,2Z)-2-(1-methoxyethylidene)-N-methylpent-3-en-1-amine.
| Compound Name | (Z,2Z)-2-(1-methoxyethylidene)-N-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 144853398 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z,2Z)-2-(1-methoxyethylidene)-N-methylpent-3-en-1-amine |
| SMILES | C/C=C\C(CNC)=C(/C)OC |
| InChI | InChI=1S/C9H17NO/c1-5-6-9(7-10-3)8(2)11-4/h5-6,10H,7H2,1-4H3/b6-5-,9-8- |
| InChIKey | YKQUWYWKPFLZNI-AFJQJTPPSA-N |
| XLogP | 1.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|