C18H23NO5 — CID 123278587
benzyl 2-(methoxycarbonylamino)-2-(8-oxabicyclo[3.2.1]octan-3-yl)acetate (PubChem CID 123278587) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is benzyl 2-(methoxycarbonylamino)-2-(8-oxabicyclo[3.2.1]octan-3-yl)acetate.
| Compound Name | benzyl 2-(methoxycarbonylamino)-2-(8-oxabicyclo[3.2.1]octan-3-yl)acetate |
|---|---|
| PubChem CID | 123278587 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | benzyl 2-(methoxycarbonylamino)-2-(8-oxabicyclo[3.2.1]octan-3-yl)acetate |
| SMILES | COC(=O)NC(C(=O)OCc1ccccc1)C1CC2CCC(C1)O2 |
| InChI | InChI=1S/C18H23NO5/c1-22-18(21)19-16(13-9-14-7-8-15(10-13)24-14)17(20)23-11-12-5-3-2-4-6-12/h2-6,13-16H,7-11H2,1H3,(H,19,21) |
| InChIKey | QXXOMWJCYNPZJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |