C17H23NO3 — CID 171936856
benzyl N-[2-(8-oxabicyclo[3.2.1]octan-3-yl)ethyl]carbamate (PubChem CID 171936856) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is benzyl N-[2-(8-oxabicyclo[3.2.1]octan-3-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-(8-oxabicyclo[3.2.1]octan-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 171936856 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | benzyl N-[2-(8-oxabicyclo[3.2.1]octan-3-yl)ethyl]carbamate |
| SMILES | O=C(NCCC1CC2CCC(C1)O2)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c19-17(20-12-13-4-2-1-3-5-13)18-9-8-14-10-15-6-7-16(11-14)21-15/h1-5,14-16H,6-12H2,(H,18,19) |
| InChIKey | SYKWSENYUWOOAK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |