C17H24N2O3 — CID 171936869
benzyl N-[2-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)ethyl]carbamate (PubChem CID 171936869) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl N-[2-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 171936869 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | benzyl N-[2-(3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)ethyl]carbamate |
| SMILES | O=C(NCCC1CC2COCC(C1)N2)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c20-17(22-10-13-4-2-1-3-5-13)18-7-6-14-8-15-11-21-12-16(9-14)19-15/h1-5,14-16,19H,6-12H2,(H,18,20) |
| InChIKey | FHLOTHUKHSJPLK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |