C30H34N2O8 — CID 123279127
N-[8-benzyl-9-methyl-2-oxo-7-(phenylmethoxymethoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide (PubChem CID 123279127) has the molecular formula C30H34N2O8 and a molecular weight of 550.61 g/mol. Its IUPAC name is N-[8-benzyl-9-methyl-2-oxo-7-(phenylmethoxymethoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide.
| Compound Name | N-[8-benzyl-9-methyl-2-oxo-7-(phenylmethoxymethoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 123279127 |
| Molecular Formula | C30H34N2O8 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | N-[8-benzyl-9-methyl-2-oxo-7-(phenylmethoxymethoxy)-1,5-dioxonan-3-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)NC2COCC(OCOCc3ccccc3)C(Cc3ccccc3)C(C)OC2=O)c1O |
| InChI | InChI=1S/C30H34N2O8/c1-20-23(15-21-9-5-3-6-10-21)26(39-19-38-16-22-11-7-4-8-12-22)18-37-17-24(30(35)40-20)32-29(34)27-28(33)25(36-2)13-14-31-27/h3-14,20,23-24,26,33H,15-19H2,1-2H3,(H,32,34) |
| InChIKey | ORIPBSMKTJUJBU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|