C27H41NOSi — CID 123279383
11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-amine (PubChem CID 123279383) has the molecular formula C27H41NOSi and a molecular weight of 423.72 g/mol. Its IUPAC name is 11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-amine.
| Compound Name | 11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-amine |
|---|---|
| PubChem CID | 123279383 |
| Molecular Formula | C27H41NOSi |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-amine |
| SMILES | CC(C)(C)[Si](OCCCCCC=CCCCCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H41NOSi/c1-27(2,3)30(25-19-13-11-14-20-25,26-21-15-12-16-22-26)29-24-18-10-8-6-4-5-7-9-17-23-28/h4-5,11-16,19-22H,6-10,17-18,23-24,28H2,1-3H3 |
| InChIKey | BJALCODVCPEHAI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|