C22H26B2O8 — CID 123282208
3-[hydroxy-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]peroxyboranyl]-4-methylbenzoic acid (PubChem CID 123282208) has the molecular formula C22H26B2O8 and a molecular weight of 440.07 g/mol. Its IUPAC name is 3-[hydroxy-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]peroxyboranyl]-4-methylbenzoic acid.
| Compound Name | 3-[hydroxy-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]peroxyboranyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 123282208 |
| Molecular Formula | C22H26B2O8 |
| Molecular Weight | 440.07 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[hydroxy-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]peroxyboranyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1B(O)OOC(=O)c1ccc(C)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H26B2O8/c1-13-7-9-15(19(25)26)11-17(13)23(28)32-29-20(27)16-10-8-14(2)18(12-16)24-30-21(3,4)22(5,6)31-24/h7-12,28H,1-6H3,(H,25,26) |
| InChIKey | CZJHECDCQNXNHU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|