C19H18N5S+ — CID 123282833
3,4-dimethyl-5-[phenyl-(4-pyridin-3-yltriazol-1-yl)methyl]-1,3-thiazol-3-ium (PubChem CID 123282833) has the molecular formula C19H18N5S+ and a molecular weight of 348.46 g/mol. Its IUPAC name is 3,4-dimethyl-5-[phenyl-(4-pyridin-3-yltriazol-1-yl)methyl]-1,3-thiazol-3-ium.
| Compound Name | 3,4-dimethyl-5-[phenyl-(4-pyridin-3-yltriazol-1-yl)methyl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 123282833 |
| Molecular Formula | C19H18N5S+ |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3,4-dimethyl-5-[phenyl-(4-pyridin-3-yltriazol-1-yl)methyl]-1,3-thiazol-3-ium |
| SMILES | Cc1c(C(c2ccccc2)n2cc(-c3cccnc3)nn2)sc[n+]1C |
| InChI | InChI=1S/C19H18N5S/c1-14-19(25-13-23(14)2)18(15-7-4-3-5-8-15)24-12-17(21-22-24)16-9-6-10-20-11-16/h3-13,18H,1-2H3/q+1 |
| InChIKey | GMDIYMYVPRHAPQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|