C21H33NO — CID 123283274
4-ethylidene-2-methyl-5a-(2-methylhexa-2,4-dienyl)-5-methylidene-3,6,7,8,9,9a-hexahydro-1H-benzo[c]azepin-8-ol (PubChem CID 123283274) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 4-ethylidene-2-methyl-5a-(2-methylhexa-2,4-dienyl)-5-methylidene-3,6,7,8,9,9a-hexahydro-1H-benzo[c]azepin-8-ol.
| Compound Name | 4-ethylidene-2-methyl-5a-(2-methylhexa-2,4-dienyl)-5-methylidene-3,6,7,8,9,9a-hexahydro-1H-benzo[c]azepin-8-ol |
|---|---|
| PubChem CID | 123283274 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 4-ethylidene-2-methyl-5a-(2-methylhexa-2,4-dienyl)-5-methylidene-3,6,7,8,9,9a-hexahydro-1H-benzo[c]azepin-8-ol |
| SMILES | C=C1C(=CC)CN(C)CC2CC(O)CCC12CC(C)=CC=CC |
| InChI | InChI=1S/C21H33NO/c1-6-8-9-16(3)13-21-11-10-20(23)12-19(21)15-22(5)14-18(7-2)17(21)4/h6-9,19-20,23H,4,10-15H2,1-3,5H3 |
| InChIKey | KGVGXVKCTGZGKF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|