C23H44NO+ — CID 123749245
2-ethyl-1-[1,5,5-trimethyl-1-(2-methylpropyl)azepan-1-ium-3-yl]octa-4,6-dien-1-ol (PubChem CID 123749245) has the molecular formula C23H44NO+ and a molecular weight of 350.61 g/mol. Its IUPAC name is 2-ethyl-1-[1,5,5-trimethyl-1-(2-methylpropyl)azepan-1-ium-3-yl]octa-4,6-dien-1-ol.
| Compound Name | 2-ethyl-1-[1,5,5-trimethyl-1-(2-methylpropyl)azepan-1-ium-3-yl]octa-4,6-dien-1-ol |
|---|---|
| PubChem CID | 123749245 |
| Molecular Formula | C23H44NO+ |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.34 |
| IUPAC Name | 2-ethyl-1-[1,5,5-trimethyl-1-(2-methylpropyl)azepan-1-ium-3-yl]octa-4,6-dien-1-ol |
| SMILES | CC=CC=CCC(CC)C(O)C1CC(C)(C)CC[N+](C)(CC(C)C)C1 |
| InChI | InChI=1S/C23H44NO/c1-8-10-11-12-13-20(9-2)22(25)21-16-23(5,6)14-15-24(7,18-21)17-19(3)4/h8,10-12,19-22,25H,9,13-18H2,1-7H3/q+1 |
| InChIKey | JMNKSQFXEYXESL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|