C60H112ClNO — CID 142740640
[3-hydroxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dienyl]-trimethylazanium chloride (PubChem CID 142740640) has the molecular formula C60H112ClNO and a molecular weight of 899.01 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dienyl]-trimethylazanium chloride.
| Compound Name | [3-hydroxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dienyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 142740640 |
| Molecular Formula | C60H112ClNO |
| Molecular Weight | 899.01 g/mol |
| Exact Mass | 897.84 |
| IUPAC Name | [3-hydroxy-2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dienyl]-trimethylazanium chloride |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(O)C(CCCCCCCC/C=C\C/C=C\CCCCC)(CCCCCCCC/C=C\C/C=C\CCCCC)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C60H112NO.ClH/c1-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55-59(62)60(58-61(4,5)6,56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-2)57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-3;/h19-24,28-33,59,62H,7-18,25-27,34-58H2,1-6H3;1H/q+1;/p-1/b22-19?,23-20-,24-21-,31-28?,32-29-,33-30-; |
| InChIKey | MXCQHQYSLAAZSX-BURLDPSYSA-M |
| XLogP | 16.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.01 |
| LogP ≤ 5 | 16.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|