C29H51NO — CID 10387953
(2S,4S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-4-ol (PubChem CID 10387953) has the molecular formula C29H51NO and a molecular weight of 429.73 g/mol. Its IUPAC name is (2S,4S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-4-ol.
| Compound Name | (2S,4S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 10387953 |
| Molecular Formula | C29H51NO |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 429.40 |
| IUPAC Name | (2S,4S)-1,3,3-trimethyl-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]piperidin-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@@H]1N(C)CC[C@H](O)C1(C)C |
| InChI | InChI=1S/C29H51NO/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-20-27-29(6,7)28(31)21-22-30(27)8/h13-15,18,27-28,31H,9-12,16-17,19-22H2,1-8H3/b24-14+,25-18+,26-15+/t27-,28-/m0/s1 |
| InChIKey | FNTVXAVKHVYQQU-WIVWZGHBSA-N |
| XLogP | 8.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|