C34H36F3NO7S — CID 123284080
methyl 2-[(3S)-6-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetate (PubChem CID 123284080) has the molecular formula C34H36F3NO7S and a molecular weight of 659.72 g/mol. Its IUPAC name is methyl 2-[(3S)-6-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-6-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 123284080 |
| Molecular Formula | C34H36F3NO7S |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | methyl 2-[(3S)-6-[[4-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2,3-dihydro-1H-inden-1-yl]-(2,2,2-trifluoroacetyl)amino]-2,3-dihydro-1-benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COc2cc(N(C(=O)C(F)(F)F)C3CCc4c(-c5c(C)cc(OCCCS(C)(=O)=O)cc5C)cccc43)ccc21 |
| InChI | InChI=1S/C34H36F3NO7S/c1-20-15-24(44-13-6-14-46(4,41)42)16-21(2)32(20)28-8-5-7-27-26(28)11-12-29(27)38(33(40)34(35,36)37)23-9-10-25-22(17-31(39)43-3)19-45-30(25)18-23/h5,7-10,15-16,18,22,29H,6,11-14,17,19H2,1-4H3/t22-,29?/m1/s1 |
| InChIKey | LZFQSZVPUBEHOG-DMDVIOLWSA-N |
| XLogP | 6.41 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|