About (ethylideneamino) 3-phenylprop-2-enimidate
(ethylideneamino) 3-phenylprop-2-enimidate (PubChem CID 123284160) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is (ethylideneamino) 3-phenylprop-2-enimidate.
Molecular Properties
| Compound Name | (ethylideneamino) 3-phenylprop-2-enimidate |
| PubChem CID | 123284160 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (ethylideneamino) 3-phenylprop-2-enimidate |
| SMILES | [H]/N=C(/C=Cc1ccccc1)ON=CC |
| InChI | InChI=1S/C11H12N2O/c1-2-13-14-11(12)9-8-10-6-4-3-5-7-10/h2-9,12H,1H3/b9-8?,12-11-,13-2? |
| InChIKey | YAKXPWSLOZSHEN-WHQSOXBXSA-N |
| XLogP | 2.70 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (ethylideneamino) 3-phenylprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (ethylideneamino) 3-phenylprop-2-enimidate?
The IUPAC name of (ethylideneamino) 3-phenylprop-2-enimidate (CID 123284160) is (ethylideneamino) 3-phenylprop-2-enimidate.
What is the SMILES notation for (ethylideneamino) 3-phenylprop-2-enimidate?
The canonical SMILES for (ethylideneamino) 3-phenylprop-2-enimidate is [H]/N=C(/C=Cc1ccccc1)ON=CC.
What is the InChIKey of (ethylideneamino) 3-phenylprop-2-enimidate?
The InChIKey is YAKXPWSLOZSHEN-WHQSOXBXSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-13-14-11(12)9-8-10-6-4-3-5-7-10/h2-9,12H,1H3/b9-8?,12-11-,13-2?.
What are the key properties of (ethylideneamino) 3-phenylprop-2-enimidate?
(ethylideneamino) 3-phenylprop-2-enimidate has a molecular weight of 188.23 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (ethylideneamino) 3-phenylprop-2-enimidate is sourced from PubChem (CID 123284160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).