C14H16KNO3 — CID 174550912
potassium;hydride;4-imino-2,2-dimethyl-3-oxo-6-phenylhex-5-enoic acid (PubChem CID 174550912) has the molecular formula C14H16KNO3 and a molecular weight of 285.38 g/mol. Its IUPAC name is potassium;hydride;4-imino-2,2-dimethyl-3-oxo-6-phenylhex-5-enoic acid.
| Compound Name | potassium;hydride;4-imino-2,2-dimethyl-3-oxo-6-phenylhex-5-enoic acid |
|---|---|
| PubChem CID | 174550912 |
| Molecular Formula | C14H16KNO3 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | potassium;hydride;4-imino-2,2-dimethyl-3-oxo-6-phenylhex-5-enoic acid |
| SMILES | [H-].[H]/N=C(\C=Cc1ccccc1)C(=O)C(C)(C)C(=O)O.[K+] |
| InChI | InChI=1S/C14H15NO3.K.H/c1-14(2,13(17)18)12(16)11(15)9-8-10-6-4-3-5-7-10;;/h3-9,15H,1-2H3,(H,17,18);;/q;+1;-1/b9-8?,15-11+;; |
| InChIKey | UFSHNKJZBKQHLS-AHTAQODPSA-N |
| XLogP | -0.48 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|