C20H19ClF3N3O2 — CID 123284385
2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)-2-[(5-fluoro-3-pyridinyl)-formylamino]acetamide (PubChem CID 123284385) has the molecular formula C20H19ClF3N3O2 and a molecular weight of 425.84 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)-2-[(5-fluoro-3-pyridinyl)-formylamino]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)-2-[(5-fluoro-3-pyridinyl)-formylamino]acetamide |
|---|---|
| PubChem CID | 123284385 |
| Molecular Formula | C20H19ClF3N3O2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(4,4-difluorocyclohexyl)-2-[(5-fluoro-3-pyridinyl)-formylamino]acetamide |
| SMILES | O=CN(c1cncc(F)c1)C(C(=O)NC1CCC(F)(F)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C20H19ClF3N3O2/c21-17-4-2-1-3-16(17)18(27(12-28)15-9-13(22)10-25-11-15)19(29)26-14-5-7-20(23,24)8-6-14/h1-4,9-12,14,18H,5-8H2,(H,26,29) |
| InChIKey | YMRGQIHAYWMBEY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|