C29H26ClF3N7O3+ — CID 123588285
[[1-(2-chlorophenyl)-2-[(4,4-difluorocyclohexyl)amino]-2-oxoethyl]-(5-fluoro-3-pyridinyl)amino]-[1-(4-cyano-2-pyridinyl)-5-oxopyrrolidin-2-yl]-oxoazanium (PubChem CID 123588285) has the molecular formula C29H26ClF3N7O3+ and a molecular weight of 613.02 g/mol. Its IUPAC name is [[1-(2-chlorophenyl)-2-[(4,4-difluorocyclohexyl)amino]-2-oxoethyl]-(5-fluoro-3-pyridinyl)amino]-[1-(4-cyano-2-pyridinyl)-5-oxopyrrolidin-2-yl]-oxoazanium.
| Compound Name | [[1-(2-chlorophenyl)-2-[(4,4-difluorocyclohexyl)amino]-2-oxoethyl]-(5-fluoro-3-pyridinyl)amino]-[1-(4-cyano-2-pyridinyl)-5-oxopyrrolidin-2-yl]-oxoazanium |
|---|---|
| PubChem CID | 123588285 |
| Molecular Formula | C29H26ClF3N7O3+ |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | [[1-(2-chlorophenyl)-2-[(4,4-difluorocyclohexyl)amino]-2-oxoethyl]-(5-fluoro-3-pyridinyl)amino]-[1-(4-cyano-2-pyridinyl)-5-oxopyrrolidin-2-yl]-oxoazanium |
| SMILES | N#Cc1ccnc(N2C(=O)CCC2[N+](=O)N(c2cncc(F)c2)C(C(=O)NC2CCC(F)(F)CC2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C29H25ClF3N7O3/c30-23-4-2-1-3-22(23)27(28(42)37-20-7-10-29(32,33)11-8-20)39(21-14-19(31)16-35-17-21)40(43)25-5-6-26(41)38(25)24-13-18(15-34)9-12-36-24/h1-4,9,12-14,16-17,20,25,27H,5-8,10-11H2/p+1 |
| InChIKey | BUKXNSUGWMEMHP-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|