C27H24ClF3N5O3+ — CID 123560814
(N-[1-(2-chlorophenyl)-2-[(3,3-difluorocyclobutyl)amino]-2-oxoethyl]-3-fluoroanilino)-oxo-(5-oxo-1-pyridin-2-ylpyrrolidin-2-yl)azanium (PubChem CID 123560814) has the molecular formula C27H24ClF3N5O3+ and a molecular weight of 558.97 g/mol. Its IUPAC name is (N-[1-(2-chlorophenyl)-2-[(3,3-difluorocyclobutyl)amino]-2-oxoethyl]-3-fluoroanilino)-oxo-(5-oxo-1-pyridin-2-ylpyrrolidin-2-yl)azanium.
| Compound Name | (N-[1-(2-chlorophenyl)-2-[(3,3-difluorocyclobutyl)amino]-2-oxoethyl]-3-fluoroanilino)-oxo-(5-oxo-1-pyridin-2-ylpyrrolidin-2-yl)azanium |
|---|---|
| PubChem CID | 123560814 |
| Molecular Formula | C27H24ClF3N5O3+ |
| Molecular Weight | 558.97 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (N-[1-(2-chlorophenyl)-2-[(3,3-difluorocyclobutyl)amino]-2-oxoethyl]-3-fluoroanilino)-oxo-(5-oxo-1-pyridin-2-ylpyrrolidin-2-yl)azanium |
| SMILES | O=C(NC1CC(F)(F)C1)C(c1ccccc1Cl)N(c1cccc(F)c1)[N+](=O)C1CCC(=O)N1c1ccccn1 |
| InChI | InChI=1S/C27H23ClF3N5O3/c28-21-9-2-1-8-20(21)25(26(38)33-18-15-27(30,31)16-18)35(19-7-5-6-17(29)14-19)36(39)23-11-12-24(37)34(23)22-10-3-4-13-32-22/h1-10,13-14,18,23,25H,11-12,15-16H2/p+1 |
| InChIKey | XGYBZPXZGZBXTN-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.97 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|