C10H18O5S — CID 123285982
4-[(3,4-dihydroxy-5-methyloxolan-2-yl)methylsulfanyl]butanoic acid (PubChem CID 123285982) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-[(3,4-dihydroxy-5-methyloxolan-2-yl)methylsulfanyl]butanoic acid.
| Compound Name | 4-[(3,4-dihydroxy-5-methyloxolan-2-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 123285982 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-[(3,4-dihydroxy-5-methyloxolan-2-yl)methylsulfanyl]butanoic acid |
| SMILES | CC1OC(CSCCCC(=O)O)C(O)C1O |
| InChI | InChI=1S/C10H18O5S/c1-6-9(13)10(14)7(15-6)5-16-4-2-3-8(11)12/h6-7,9-10,13-14H,2-5H2,1H3,(H,11,12) |
| InChIKey | YLWKGCVWHZNQED-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|