C10H16O5S2 — CID 102012808
S-[[(2R,3S,4S,5R)-5-(acetylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]methyl] ethanethioate (PubChem CID 102012808) has the molecular formula C10H16O5S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is S-[[(2R,3S,4S,5R)-5-(acetylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2R,3S,4S,5R)-5-(acetylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 102012808 |
| Molecular Formula | C10H16O5S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | S-[[(2R,3S,4S,5R)-5-(acetylsulfanylmethyl)-3,4-dihydroxyoxolan-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H]1O[C@@H](CSC(C)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O5S2/c1-5(11)16-3-7-9(13)10(14)8(15-7)4-17-6(2)12/h7-10,13-14H,3-4H2,1-2H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | YAQMCTPCCKHGBX-AXTSPUMRSA-N |
| XLogP | 0.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|