C11H22O4S — CID 54378259
(2S,3R,4R,5R)-2-hexylsulfanyl-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 54378259) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-hexylsulfanyl-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-hexylsulfanyl-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54378259 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2S,3R,4R,5R)-2-hexylsulfanyl-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCS[C@@H]1O[C@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H22O4S/c1-2-3-4-5-6-16-11-10(14)9(13)8(7-12)15-11/h8-14H,2-7H2,1H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | UYCILQKKPIKRNF-YTWAJWBKSA-N |
| XLogP | 0.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|