C24H36N6O2 — CID 123286990
2-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-6-cyclopropyl-5-[1-(2-hydrazinylethoxy)butyl]pyridine-3-carbonitrile (PubChem CID 123286990) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-6-cyclopropyl-5-[1-(2-hydrazinylethoxy)butyl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-6-cyclopropyl-5-[1-(2-hydrazinylethoxy)butyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123286990 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 2-[4-(cyclopropanecarbonyl)-3-methylpiperazin-1-yl]-6-cyclopropyl-5-[1-(2-hydrazinylethoxy)butyl]pyridine-3-carbonitrile |
| SMILES | CCCC(OCCNN)c1cc(C#N)c(N2CCN(C(=O)C3CC3)C(C)C2)nc1C1CC1 |
| InChI | InChI=1S/C24H36N6O2/c1-3-4-21(32-12-9-27-26)20-13-19(14-25)23(28-22(20)17-5-6-17)29-10-11-30(16(2)15-29)24(31)18-7-8-18/h13,16-18,21,27H,3-12,15,26H2,1-2H3 |
| InChIKey | HJSDUQXTCBUKSG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|