C26H35BN4O3 — CID 71119303
2-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-6-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (PubChem CID 71119303) has the molecular formula C26H35BN4O3 and a molecular weight of 462.40 g/mol. Its IUPAC name is 2-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-6-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-6-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71119303 |
| Molecular Formula | C26H35BN4O3 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-6-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| SMILES | CC1(C)OB(c2cc(C#N)c(N3CCN(C(=O)C4CC4)C(C4CC4)C3)nc2C2CC2)OC1(C)C |
| InChI | InChI=1S/C26H35BN4O3/c1-25(2)26(3,4)34-27(33-25)20-13-19(14-28)23(29-22(20)17-7-8-17)30-11-12-31(24(32)18-9-10-18)21(15-30)16-5-6-16/h13,16-18,21H,5-12,15H2,1-4H3 |
| InChIKey | XMBMPJBQITYDET-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|